C18H18ClF3N2S — CID 134569674
2-chloro-N-[5-(2,2-difluoropropylsulfanyl)-2-fluoro-4-methylphenyl]-N'-methylbenzenecarboximidamide (PubChem CID 134569674) has the molecular formula C18H18ClF3N2S and a molecular weight of 386.87 g/mol. Its IUPAC name is 2-chloro-N-[5-(2,2-difluoropropylsulfanyl)-2-fluoro-4-methylphenyl]-N'-methylbenzenecarboximidamide.
| Compound Name | 2-chloro-N-[5-(2,2-difluoropropylsulfanyl)-2-fluoro-4-methylphenyl]-N'-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 134569674 |
| Molecular Formula | C18H18ClF3N2S |
| Molecular Weight | 386.87 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | 2-chloro-N-[5-(2,2-difluoropropylsulfanyl)-2-fluoro-4-methylphenyl]-N'-methylbenzenecarboximidamide |
| SMILES | C/N=C(/Nc1cc(SCC(C)(F)F)c(C)cc1F)c1ccccc1Cl |
| InChI | InChI=1S/C18H18ClF3N2S/c1-11-8-14(20)15(9-16(11)25-10-18(2,21)22)24-17(23-3)12-6-4-5-7-13(12)19/h4-9H,10H2,1-3H3,(H,23,24) |
| InChIKey | HALUZMQJPJWREF-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.87 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|