C13H16F4N2O2S2 — CID 165389631
ethyl N-[[2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfanyl)anilino]methylsulfanyl]carbamate (PubChem CID 165389631) has the molecular formula C13H16F4N2O2S2 and a molecular weight of 372.41 g/mol. Its IUPAC name is ethyl N-[[2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfanyl)anilino]methylsulfanyl]carbamate.
| Compound Name | ethyl N-[[2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfanyl)anilino]methylsulfanyl]carbamate |
|---|---|
| PubChem CID | 165389631 |
| Molecular Formula | C13H16F4N2O2S2 |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | ethyl N-[[2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfanyl)anilino]methylsulfanyl]carbamate |
| SMILES | CCOC(=O)NSCNc1cc(SCC(F)(F)F)c(C)cc1F |
| InChI | InChI=1S/C13H16F4N2O2S2/c1-3-21-12(20)19-23-7-18-10-5-11(8(2)4-9(10)14)22-6-13(15,16)17/h4-5,18H,3,6-7H2,1-2H3,(H,19,20) |
| InChIKey | CHCKECPOXLZHMT-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|