C9H9BF4O2S — CID 22170959
[2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfanyl)phenyl]boronic acid (PubChem CID 22170959) has the molecular formula C9H9BF4O2S and a molecular weight of 268.04 g/mol. Its IUPAC name is [2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfanyl)phenyl]boronic acid.
| Compound Name | [2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfanyl)phenyl]boronic acid |
|---|---|
| PubChem CID | 22170959 |
| Molecular Formula | C9H9BF4O2S |
| Molecular Weight | 268.04 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | [2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfanyl)phenyl]boronic acid |
| SMILES | Cc1cc(F)c(B(O)O)cc1SCC(F)(F)F |
| InChI | InChI=1S/C9H9BF4O2S/c1-5-2-7(11)6(10(15)16)3-8(5)17-4-9(12,13)14/h2-3,15-16H,4H2,1H3 |
| InChIKey | UUMBKCVJCRBIJK-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.04 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|