C17H18F4N4OS — CID 144760462
1,3-diamino-1-[2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfanyl)phenyl]-3-(4-methylphenyl)urea (PubChem CID 144760462) has the molecular formula C17H18F4N4OS and a molecular weight of 402.42 g/mol. Its IUPAC name is 1,3-diamino-1-[2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfanyl)phenyl]-3-(4-methylphenyl)urea.
| Compound Name | 1,3-diamino-1-[2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfanyl)phenyl]-3-(4-methylphenyl)urea |
|---|---|
| PubChem CID | 144760462 |
| Molecular Formula | C17H18F4N4OS |
| Molecular Weight | 402.42 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | 1,3-diamino-1-[2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfanyl)phenyl]-3-(4-methylphenyl)urea |
| SMILES | Cc1ccc(N(N)C(=O)N(N)c2cc(SCC(F)(F)F)c(C)cc2F)cc1 |
| InChI | InChI=1S/C17H18F4N4OS/c1-10-3-5-12(6-4-10)24(22)16(26)25(23)14-8-15(11(2)7-13(14)18)27-9-17(19,20)21/h3-8H,9,22-23H2,1-2H3 |
| InChIKey | OIJZZCLKWPYTIK-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.42 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|