C22H18F6N6S2 — CID 51030104
1-[5-[[2,4-dimethyl-5-[3-(trifluoromethyl)-1,2,4-triazol-1-yl]phenyl]disulfanyl]-2,4-dimethylphenyl]-3-(trifluoromethyl)-1,2,4-triazole (PubChem CID 51030104) has the molecular formula C22H18F6N6S2 and a molecular weight of 544.55 g/mol. Its IUPAC name is 1-[5-[[2,4-dimethyl-5-[3-(trifluoromethyl)-1,2,4-triazol-1-yl]phenyl]disulfanyl]-2,4-dimethylphenyl]-3-(trifluoromethyl)-1,2,4-triazole.
| Compound Name | 1-[5-[[2,4-dimethyl-5-[3-(trifluoromethyl)-1,2,4-triazol-1-yl]phenyl]disulfanyl]-2,4-dimethylphenyl]-3-(trifluoromethyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 51030104 |
| Molecular Formula | C22H18F6N6S2 |
| Molecular Weight | 544.55 g/mol |
| Exact Mass | 544.09 |
| IUPAC Name | 1-[5-[[2,4-dimethyl-5-[3-(trifluoromethyl)-1,2,4-triazol-1-yl]phenyl]disulfanyl]-2,4-dimethylphenyl]-3-(trifluoromethyl)-1,2,4-triazole |
| SMILES | Cc1cc(C)c(-n2cnc(C(F)(F)F)n2)cc1SSc1cc(-n2cnc(C(F)(F)F)n2)c(C)cc1C |
| InChI | InChI=1S/C22H18F6N6S2/c1-11-5-13(3)17(7-15(11)33-9-29-19(31-33)21(23,24)25)35-36-18-8-16(12(2)6-14(18)4)34-10-30-20(32-34)22(26,27)28/h5-10H,1-4H3 |
| InChIKey | XUIJIDIBDQWCKF-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.55 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|