C14H12F7N3S — CID 58152679
3-(difluoromethyl)-1-[2,4-dimethyl-5-(2,2,3,3,3-pentafluoropropylsulfanyl)phenyl]-1,2,4-triazole (PubChem CID 58152679) has the molecular formula C14H12F7N3S and a molecular weight of 387.32 g/mol. Its IUPAC name is 3-(difluoromethyl)-1-[2,4-dimethyl-5-(2,2,3,3,3-pentafluoropropylsulfanyl)phenyl]-1,2,4-triazole.
| Compound Name | 3-(difluoromethyl)-1-[2,4-dimethyl-5-(2,2,3,3,3-pentafluoropropylsulfanyl)phenyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 58152679 |
| Molecular Formula | C14H12F7N3S |
| Molecular Weight | 387.32 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | 3-(difluoromethyl)-1-[2,4-dimethyl-5-(2,2,3,3,3-pentafluoropropylsulfanyl)phenyl]-1,2,4-triazole |
| SMILES | Cc1cc(C)c(-n2cnc(C(F)F)n2)cc1SCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H12F7N3S/c1-7-3-8(2)10(25-5-13(17,18)14(19,20)21)4-9(7)24-6-22-12(23-24)11(15)16/h3-4,6,11H,5H2,1-2H3 |
| InChIKey | DTVNFIFUMNOUGX-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.32 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|