C15H11ClF9N3S — CID 50991084
1-[5-(3-chloro-2,2,3,3-tetrafluoropropyl)sulfanyl-2,4-dimethylphenyl]-3-(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazole (PubChem CID 50991084) has the molecular formula C15H11ClF9N3S and a molecular weight of 471.78 g/mol. Its IUPAC name is 1-[5-(3-chloro-2,2,3,3-tetrafluoropropyl)sulfanyl-2,4-dimethylphenyl]-3-(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazole.
| Compound Name | 1-[5-(3-chloro-2,2,3,3-tetrafluoropropyl)sulfanyl-2,4-dimethylphenyl]-3-(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 50991084 |
| Molecular Formula | C15H11ClF9N3S |
| Molecular Weight | 471.78 g/mol |
| Exact Mass | 471.02 |
| IUPAC Name | 1-[5-(3-chloro-2,2,3,3-tetrafluoropropyl)sulfanyl-2,4-dimethylphenyl]-3-(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazole |
| SMILES | Cc1cc(C)c(-n2cnc(C(F)(F)C(F)(F)F)n2)cc1SCC(F)(F)C(F)(F)Cl |
| InChI | InChI=1S/C15H11ClF9N3S/c1-7-3-8(2)10(29-5-12(17,18)14(16,21)22)4-9(7)28-6-26-11(27-28)13(19,20)15(23,24)25/h3-4,6H,5H2,1-2H3 |
| InChIKey | FXUDERPCZJOFSJ-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.78 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|