C18H21F3N6 — CID 58370439
4-[[3-tert-butyl-4-[3-(trifluoromethyl)-1,2,4-triazol-1-yl]pyrazol-1-yl]methyl]-2-methylaniline (PubChem CID 58370439) has the molecular formula C18H21F3N6 and a molecular weight of 378.40 g/mol. Its IUPAC name is 4-[[3-tert-butyl-4-[3-(trifluoromethyl)-1,2,4-triazol-1-yl]pyrazol-1-yl]methyl]-2-methylaniline.
| Compound Name | 4-[[3-tert-butyl-4-[3-(trifluoromethyl)-1,2,4-triazol-1-yl]pyrazol-1-yl]methyl]-2-methylaniline |
|---|---|
| PubChem CID | 58370439 |
| Molecular Formula | C18H21F3N6 |
| Molecular Weight | 378.40 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 4-[[3-tert-butyl-4-[3-(trifluoromethyl)-1,2,4-triazol-1-yl]pyrazol-1-yl]methyl]-2-methylaniline |
| SMILES | Cc1cc(Cn2cc(-n3cnc(C(F)(F)F)n3)c(C(C)(C)C)n2)ccc1N |
| InChI | InChI=1S/C18H21F3N6/c1-11-7-12(5-6-13(11)22)8-26-9-14(15(24-26)17(2,3)4)27-10-23-16(25-27)18(19,20)21/h5-7,9-10H,8,22H2,1-4H3 |
| InChIKey | ZDPBZTVGLWBUQP-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.40 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|