C17H13ClF5N5 — CID 87300119
4-[[5-(3-chloro-2-pyridinyl)-3-(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazol-1-yl]methyl]-2-methylaniline (PubChem CID 87300119) has the molecular formula C17H13ClF5N5 and a molecular weight of 417.77 g/mol. Its IUPAC name is 4-[[5-(3-chloro-2-pyridinyl)-3-(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazol-1-yl]methyl]-2-methylaniline.
| Compound Name | 4-[[5-(3-chloro-2-pyridinyl)-3-(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazol-1-yl]methyl]-2-methylaniline |
|---|---|
| PubChem CID | 87300119 |
| Molecular Formula | C17H13ClF5N5 |
| Molecular Weight | 417.77 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | 4-[[5-(3-chloro-2-pyridinyl)-3-(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazol-1-yl]methyl]-2-methylaniline |
| SMILES | Cc1cc(Cn2nc(C(F)(F)C(F)(F)F)nc2-c2ncccc2Cl)ccc1N |
| InChI | InChI=1S/C17H13ClF5N5/c1-9-7-10(4-5-12(9)24)8-28-14(13-11(18)3-2-6-25-13)26-15(27-28)16(19,20)17(21,22)23/h2-7H,8,24H2,1H3 |
| InChIKey | FPHSKAHYVKYKBM-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.77 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|