C13H9F10N5 — CID 87299764
6-[[3,5-bis(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazol-1-yl]methyl]-2-methylpyridin-3-amine (PubChem CID 87299764) has the molecular formula C13H9F10N5 and a molecular weight of 425.23 g/mol. Its IUPAC name is 6-[[3,5-bis(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazol-1-yl]methyl]-2-methylpyridin-3-amine.
| Compound Name | 6-[[3,5-bis(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazol-1-yl]methyl]-2-methylpyridin-3-amine |
|---|---|
| PubChem CID | 87299764 |
| Molecular Formula | C13H9F10N5 |
| Molecular Weight | 425.23 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | 6-[[3,5-bis(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazol-1-yl]methyl]-2-methylpyridin-3-amine |
| SMILES | Cc1nc(Cn2nc(C(F)(F)C(F)(F)F)nc2C(F)(F)C(F)(F)F)ccc1N |
| InChI | InChI=1S/C13H9F10N5/c1-5-7(24)3-2-6(25-5)4-28-9(11(16,17)13(21,22)23)26-8(27-28)10(14,15)12(18,19)20/h2-3H,4,24H2,1H3 |
| InChIKey | SYANKGIKUUCJQA-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.23 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|