C14H10F10N4 — CID 87452435
4-[[3,5-bis(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazol-4-yl]methyl]-2-methylaniline (PubChem CID 87452435) has the molecular formula C14H10F10N4 and a molecular weight of 424.24 g/mol. Its IUPAC name is 4-[[3,5-bis(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazol-4-yl]methyl]-2-methylaniline.
| Compound Name | 4-[[3,5-bis(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazol-4-yl]methyl]-2-methylaniline |
|---|---|
| PubChem CID | 87452435 |
| Molecular Formula | C14H10F10N4 |
| Molecular Weight | 424.24 g/mol |
| Exact Mass | 424.07 |
| IUPAC Name | 4-[[3,5-bis(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazol-4-yl]methyl]-2-methylaniline |
| SMILES | Cc1cc(Cn2c(C(F)(F)C(F)(F)F)nnc2C(F)(F)C(F)(F)F)ccc1N |
| InChI | InChI=1S/C14H10F10N4/c1-6-4-7(2-3-8(6)25)5-28-9(11(15,16)13(19,20)21)26-27-10(28)12(17,18)14(22,23)24/h2-4H,5,25H2,1H3 |
| InChIKey | GMCOHWHQOLIMKC-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.24 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|