C16H14F3N5O — CID 67175145
2-[(4-amino-3-methylphenyl)methyl]-1-[4-(trifluoromethyl)phenyl]tetrazol-5-one (PubChem CID 67175145) has the molecular formula C16H14F3N5O and a molecular weight of 349.32 g/mol. Its IUPAC name is 2-[(4-amino-3-methylphenyl)methyl]-1-[4-(trifluoromethyl)phenyl]tetrazol-5-one.
| Compound Name | 2-[(4-amino-3-methylphenyl)methyl]-1-[4-(trifluoromethyl)phenyl]tetrazol-5-one |
|---|---|
| PubChem CID | 67175145 |
| Molecular Formula | C16H14F3N5O |
| Molecular Weight | 349.32 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 2-[(4-amino-3-methylphenyl)methyl]-1-[4-(trifluoromethyl)phenyl]tetrazol-5-one |
| SMILES | Cc1cc(Cn2nnc(=O)n2-c2ccc(C(F)(F)F)cc2)ccc1N |
| InChI | InChI=1S/C16H14F3N5O/c1-10-8-11(2-7-14(10)20)9-23-22-21-15(25)24(23)13-5-3-12(4-6-13)16(17,18)19/h2-8H,9,20H2,1H3 |
| InChIKey | CMAGVVQHJHAPDM-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 78.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.32 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|