C21H14F11N3 — CID 87346511
4-[[4-[3,5-bis(trifluoromethyl)phenyl]-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-1-yl]methyl]-2-methylaniline (PubChem CID 87346511) has the molecular formula C21H14F11N3 and a molecular weight of 517.34 g/mol. Its IUPAC name is 4-[[4-[3,5-bis(trifluoromethyl)phenyl]-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-1-yl]methyl]-2-methylaniline.
| Compound Name | 4-[[4-[3,5-bis(trifluoromethyl)phenyl]-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-1-yl]methyl]-2-methylaniline |
|---|---|
| PubChem CID | 87346511 |
| Molecular Formula | C21H14F11N3 |
| Molecular Weight | 517.34 g/mol |
| Exact Mass | 517.10 |
| IUPAC Name | 4-[[4-[3,5-bis(trifluoromethyl)phenyl]-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-1-yl]methyl]-2-methylaniline |
| SMILES | Cc1cc(Cn2cc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)c(C(F)(F)C(F)(F)F)n2)ccc1N |
| InChI | InChI=1S/C21H14F11N3/c1-10-4-11(2-3-16(10)33)8-35-9-15(17(34-35)18(22,23)21(30,31)32)12-5-13(19(24,25)26)7-14(6-12)20(27,28)29/h2-7,9H,8,33H2,1H3 |
| InChIKey | WKWFTBXNALZGLL-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.34 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|