C14H9F10N3 — CID 87299304
4-[[3,4-bis(1,1,2,2,2-pentafluoroethyl)pyrazol-1-yl]methyl]aniline (PubChem CID 87299304) has the molecular formula C14H9F10N3 and a molecular weight of 409.23 g/mol. Its IUPAC name is 4-[[3,4-bis(1,1,2,2,2-pentafluoroethyl)pyrazol-1-yl]methyl]aniline.
| Compound Name | 4-[[3,4-bis(1,1,2,2,2-pentafluoroethyl)pyrazol-1-yl]methyl]aniline |
|---|---|
| PubChem CID | 87299304 |
| Molecular Formula | C14H9F10N3 |
| Molecular Weight | 409.23 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | 4-[[3,4-bis(1,1,2,2,2-pentafluoroethyl)pyrazol-1-yl]methyl]aniline |
| SMILES | Nc1ccc(Cn2cc(C(F)(F)C(F)(F)F)c(C(F)(F)C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C14H9F10N3/c15-11(16,13(19,20)21)9-6-27(5-7-1-3-8(25)4-2-7)26-10(9)12(17,18)14(22,23)24/h1-4,6H,5,25H2 |
| InChIKey | UNJMBSJHDZMXEW-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.23 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|