C13H11F7N4 — CID 87298974
4-[[1-(difluoromethyl)-5-(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazol-3-yl]methyl]-2-methylaniline (PubChem CID 87298974) has the molecular formula C13H11F7N4 and a molecular weight of 356.25 g/mol. Its IUPAC name is 4-[[1-(difluoromethyl)-5-(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazol-3-yl]methyl]-2-methylaniline.
| Compound Name | 4-[[1-(difluoromethyl)-5-(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazol-3-yl]methyl]-2-methylaniline |
|---|---|
| PubChem CID | 87298974 |
| Molecular Formula | C13H11F7N4 |
| Molecular Weight | 356.25 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | 4-[[1-(difluoromethyl)-5-(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazol-3-yl]methyl]-2-methylaniline |
| SMILES | Cc1cc(Cc2nc(C(F)(F)C(F)(F)F)n(C(F)F)n2)ccc1N |
| InChI | InChI=1S/C13H11F7N4/c1-6-4-7(2-3-8(6)21)5-9-22-10(24(23-9)11(14)15)12(16,17)13(18,19)20/h2-4,11H,5,21H2,1H3 |
| InChIKey | DYMBXZPVLQCLFW-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.25 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|