C20H15F8N3 — CID 87298685
2-methyl-3-[[3-(1,1,2,2,2-pentafluoroethyl)-4-[4-(trifluoromethyl)phenyl]pyrazol-1-yl]methyl]aniline (PubChem CID 87298685) has the molecular formula C20H15F8N3 and a molecular weight of 449.35 g/mol. Its IUPAC name is 2-methyl-3-[[3-(1,1,2,2,2-pentafluoroethyl)-4-[4-(trifluoromethyl)phenyl]pyrazol-1-yl]methyl]aniline.
| Compound Name | 2-methyl-3-[[3-(1,1,2,2,2-pentafluoroethyl)-4-[4-(trifluoromethyl)phenyl]pyrazol-1-yl]methyl]aniline |
|---|---|
| PubChem CID | 87298685 |
| Molecular Formula | C20H15F8N3 |
| Molecular Weight | 449.35 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | 2-methyl-3-[[3-(1,1,2,2,2-pentafluoroethyl)-4-[4-(trifluoromethyl)phenyl]pyrazol-1-yl]methyl]aniline |
| SMILES | Cc1c(N)cccc1Cn1cc(-c2ccc(C(F)(F)F)cc2)c(C(F)(F)C(F)(F)F)n1 |
| InChI | InChI=1S/C20H15F8N3/c1-11-13(3-2-4-16(11)29)9-31-10-15(17(30-31)18(21,22)20(26,27)28)12-5-7-14(8-6-12)19(23,24)25/h2-8,10H,9,29H2,1H3 |
| InChIKey | JCNWTBYKFDQQOR-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.35 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|