C19H22ClN7O2 — CID 160721031
3-(3-chloropyrazol-1-yl)pyridine;N-(3-oxobut-1-en-2-yl)acetamide;pyridin-3-ylhydrazine (PubChem CID 160721031) has the molecular formula C19H22ClN7O2 and a molecular weight of 415.89 g/mol. Its IUPAC name is 3-(3-chloropyrazol-1-yl)pyridine;N-(3-oxobut-1-en-2-yl)acetamide;pyridin-3-ylhydrazine.
| Compound Name | 3-(3-chloropyrazol-1-yl)pyridine;N-(3-oxobut-1-en-2-yl)acetamide;pyridin-3-ylhydrazine |
|---|---|
| PubChem CID | 160721031 |
| Molecular Formula | C19H22ClN7O2 |
| Molecular Weight | 415.89 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 3-(3-chloropyrazol-1-yl)pyridine;N-(3-oxobut-1-en-2-yl)acetamide;pyridin-3-ylhydrazine |
| SMILES | C=C(NC(C)=O)C(C)=O.Clc1ccn(-c2cccnc2)n1.NNc1cccnc1 |
| InChI | InChI=1S/C8H6ClN3.C6H9NO2.C5H7N3/c9-8-3-5-12(11-8)7-2-1-4-10-6-7;1-4(5(2)8)7-6(3)9;6-8-5-2-1-3-7-4-5/h1-6H;1H2,2-3H3,(H,7,9);1-4,8H,6H2 |
| InChIKey | RTCJKTUAORYCJU-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 127.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.89 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|