C26H39N3O6 — CID 160721569
[1-(2-oxoheptyl)-4-[3-(phenylmethoxycarbonylamino)propanoyl]piperazin-2-yl]methyl propanoate (PubChem CID 160721569) has the molecular formula C26H39N3O6 and a molecular weight of 489.61 g/mol. Its IUPAC name is [1-(2-oxoheptyl)-4-[3-(phenylmethoxycarbonylamino)propanoyl]piperazin-2-yl]methyl propanoate.
| Compound Name | [1-(2-oxoheptyl)-4-[3-(phenylmethoxycarbonylamino)propanoyl]piperazin-2-yl]methyl propanoate |
|---|---|
| PubChem CID | 160721569 |
| Molecular Formula | C26H39N3O6 |
| Molecular Weight | 489.61 g/mol |
| Exact Mass | 489.28 |
| IUPAC Name | [1-(2-oxoheptyl)-4-[3-(phenylmethoxycarbonylamino)propanoyl]piperazin-2-yl]methyl propanoate |
| SMILES | CCCCCC(=O)CN1CCN(C(=O)CCNC(=O)OCc2ccccc2)CC1COC(=O)CC |
| InChI | InChI=1S/C26H39N3O6/c1-3-5-7-12-23(30)18-28-15-16-29(17-22(28)20-34-25(32)4-2)24(31)13-14-27-26(33)35-19-21-10-8-6-9-11-21/h6,8-11,22H,3-5,7,12-20H2,1-2H3,(H,27,33) |
| InChIKey | OPIBLDRNFSCAIJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.61 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|