C16H19NO2 — CID 160727618
propan-2-yl 2-(4,6-dimethylquinolin-3-yl)acetate (PubChem CID 160727618) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is propan-2-yl 2-(4,6-dimethylquinolin-3-yl)acetate.
| Compound Name | propan-2-yl 2-(4,6-dimethylquinolin-3-yl)acetate |
|---|---|
| PubChem CID | 160727618 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | propan-2-yl 2-(4,6-dimethylquinolin-3-yl)acetate |
| SMILES | Cc1ccc2ncc(CC(=O)OC(C)C)c(C)c2c1 |
| InChI | InChI=1S/C16H19NO2/c1-10(2)19-16(18)8-13-9-17-15-6-5-11(3)7-14(15)12(13)4/h5-7,9-10H,8H2,1-4H3 |
| InChIKey | DREOEMIMAINGAY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |