propan-2-yl 2-(4,6-dimethylquinolin-3-yl)acetate

C16H19NO2 — CID 160727618

IUPACpropan-2-yl 2-(4,6-dimethylquinolin-3-yl)acetate
SMILESCc1ccc2ncc(CC(=O)OC(C)C)c(C)c2c1
InChIInChI=1S/C16H19NO2/c1-10(2)19-16(18)8-13-9-17-15-6-5-11(3)7-14(15)12(13)4/h5-7,9-10H,8H2,1-4H3
InChIKeyDREOEMIMAINGAY-UHFFFAOYSA-N
MW257.33 g/mol
LogP3.35
Rot. Bonds3

About propan-2-yl 2-(4,6-dimethylquinolin-3-yl)acetate

propan-2-yl 2-(4,6-dimethylquinolin-3-yl)acetate (PubChem CID 160727618) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is propan-2-yl 2-(4,6-dimethylquinolin-3-yl)acetate.

Molecular Properties

Compound Namepropan-2-yl 2-(4,6-dimethylquinolin-3-yl)acetate
PubChem CID160727618
Molecular FormulaC16H19NO2
Molecular Weight257.33 g/mol
Exact Mass257.14
IUPAC Namepropan-2-yl 2-(4,6-dimethylquinolin-3-yl)acetate
SMILESCc1ccc2ncc(CC(=O)OC(C)C)c(C)c2c1
InChIInChI=1S/C16H19NO2/c1-10(2)19-16(18)8-13-9-17-15-6-5-11(3)7-14(15)12(13)4/h5-7,9-10H,8H2,1-4H3
InChIKeyDREOEMIMAINGAY-UHFFFAOYSA-N
XLogP3.35
TPSA39.19 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500257.33
LogP ≤ 53.35
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze propan-2-yl 2-(4,6-dimethylquinolin-3-yl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of propan-2-yl 2-(4,6-dimethylquinolin-3-yl)acetate?
The IUPAC name of propan-2-yl 2-(4,6-dimethylquinolin-3-yl)acetate (CID 160727618) is propan-2-yl 2-(4,6-dimethylquinolin-3-yl)acetate.
What is the SMILES notation for propan-2-yl 2-(4,6-dimethylquinolin-3-yl)acetate?
The canonical SMILES for propan-2-yl 2-(4,6-dimethylquinolin-3-yl)acetate is Cc1ccc2ncc(CC(=O)OC(C)C)c(C)c2c1.
What is the InChIKey of propan-2-yl 2-(4,6-dimethylquinolin-3-yl)acetate?
The InChIKey is DREOEMIMAINGAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO2/c1-10(2)19-16(18)8-13-9-17-15-6-5-11(3)7-14(15)12(13)4/h5-7,9-10H,8H2,1-4H3.
What are the key properties of propan-2-yl 2-(4,6-dimethylquinolin-3-yl)acetate?
propan-2-yl 2-(4,6-dimethylquinolin-3-yl)acetate has a molecular weight of 257.33 g/mol, XLogP of 3.35, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-(4,6-dimethylquinolin-3-yl)acetate is sourced from PubChem (CID 160727618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).