C28H42O2 — CID 160728606
1-(2-ethyl-4-methylpentyl)-2-methoxybenzene;1-methoxy-2-prop-2-enylbenzene;prop-1-ene (PubChem CID 160728606) has the molecular formula C28H42O2 and a molecular weight of 410.64 g/mol. Its IUPAC name is 1-(2-ethyl-4-methylpentyl)-2-methoxybenzene;1-methoxy-2-prop-2-enylbenzene;prop-1-ene.
| Compound Name | 1-(2-ethyl-4-methylpentyl)-2-methoxybenzene;1-methoxy-2-prop-2-enylbenzene;prop-1-ene |
|---|---|
| PubChem CID | 160728606 |
| Molecular Formula | C28H42O2 |
| Molecular Weight | 410.64 g/mol |
| Exact Mass | 410.32 |
| IUPAC Name | 1-(2-ethyl-4-methylpentyl)-2-methoxybenzene;1-methoxy-2-prop-2-enylbenzene;prop-1-ene |
| SMILES | C=CC.C=CCc1ccccc1OC.CCC(Cc1ccccc1OC)CC(C)C |
| InChI | InChI=1S/C15H24O.C10H12O.C3H6/c1-5-13(10-12(2)3)11-14-8-6-7-9-15(14)16-4;1-3-6-9-7-4-5-8-10(9)11-2;1-3-2/h6-9,12-13H,5,10-11H2,1-4H3;3-5,7-8H,1,6H2,2H3;3H,1H2,2H3 |
| InChIKey | RUAPEZOTKVXAIQ-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.64 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|