C34H54O2 — CID 159343707
1-(2-ethyl-4-methyloctyl)-2-methoxybenzene;hex-1-ene;1-methoxy-2-prop-2-enylbenzene (PubChem CID 159343707) has the molecular formula C34H54O2 and a molecular weight of 494.80 g/mol. Its IUPAC name is 1-(2-ethyl-4-methyloctyl)-2-methoxybenzene;hex-1-ene;1-methoxy-2-prop-2-enylbenzene.
| Compound Name | 1-(2-ethyl-4-methyloctyl)-2-methoxybenzene;hex-1-ene;1-methoxy-2-prop-2-enylbenzene |
|---|---|
| PubChem CID | 159343707 |
| Molecular Formula | C34H54O2 |
| Molecular Weight | 494.80 g/mol |
| Exact Mass | 494.41 |
| IUPAC Name | 1-(2-ethyl-4-methyloctyl)-2-methoxybenzene;hex-1-ene;1-methoxy-2-prop-2-enylbenzene |
| SMILES | C=CCCCC.C=CCc1ccccc1OC.CCCCC(C)CC(CC)Cc1ccccc1OC |
| InChI | InChI=1S/C18H30O.C10H12O.C6H12/c1-5-7-10-15(3)13-16(6-2)14-17-11-8-9-12-18(17)19-4;1-3-6-9-7-4-5-8-10(9)11-2;1-3-5-6-4-2/h8-9,11-12,15-16H,5-7,10,13-14H2,1-4H3;3-5,7-8H,1,6H2,2H3;3H,1,4-6H2,2H3 |
| InChIKey | LGLKOLQFDVTUSE-UHFFFAOYSA-N |
| XLogP | 10.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.80 |
| LogP ≤ 5 | 10.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|