C14H16F3NO4S — CID 160730248
tert-butyl 3-[5-nitro-2-(trifluoromethylsulfanyl)phenyl]propanoate (PubChem CID 160730248) has the molecular formula C14H16F3NO4S and a molecular weight of 351.35 g/mol. Its IUPAC name is tert-butyl 3-[5-nitro-2-(trifluoromethylsulfanyl)phenyl]propanoate.
| Compound Name | tert-butyl 3-[5-nitro-2-(trifluoromethylsulfanyl)phenyl]propanoate |
|---|---|
| PubChem CID | 160730248 |
| Molecular Formula | C14H16F3NO4S |
| Molecular Weight | 351.35 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | tert-butyl 3-[5-nitro-2-(trifluoromethylsulfanyl)phenyl]propanoate |
| SMILES | CC(C)(C)OC(=O)CCc1cc([N+](=O)[O-])ccc1SC(F)(F)F |
| InChI | InChI=1S/C14H16F3NO4S/c1-13(2,3)22-12(19)7-4-9-8-10(18(20)21)5-6-11(9)23-14(15,16)17/h5-6,8H,4,7H2,1-3H3 |
| InChIKey | RUFWNHXHKLIVAK-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.35 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|