C14H16F3NO6S — CID 153017395
tert-butyl 3-[5-nitro-2-(trifluoromethylsulfonyl)phenyl]propanoate (PubChem CID 153017395) has the molecular formula C14H16F3NO6S and a molecular weight of 383.34 g/mol. Its IUPAC name is tert-butyl 3-[5-nitro-2-(trifluoromethylsulfonyl)phenyl]propanoate.
| Compound Name | tert-butyl 3-[5-nitro-2-(trifluoromethylsulfonyl)phenyl]propanoate |
|---|---|
| PubChem CID | 153017395 |
| Molecular Formula | C14H16F3NO6S |
| Molecular Weight | 383.34 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | tert-butyl 3-[5-nitro-2-(trifluoromethylsulfonyl)phenyl]propanoate |
| SMILES | CC(C)(C)OC(=O)CCc1cc([N+](=O)[O-])ccc1S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C14H16F3NO6S/c1-13(2,3)24-12(19)7-4-9-8-10(18(20)21)5-6-11(9)25(22,23)14(15,16)17/h5-6,8H,4,7H2,1-3H3 |
| InChIKey | VBGFZCOXJJVMFR-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 103.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.34 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|