C18H19NO6S — CID 91335332
ethyl (2R)-2-(4-nitrophenyl)sulfonyl-4-phenylbutanoate (PubChem CID 91335332) has the molecular formula C18H19NO6S and a molecular weight of 377.42 g/mol. Its IUPAC name is ethyl (2R)-2-(4-nitrophenyl)sulfonyl-4-phenylbutanoate.
| Compound Name | ethyl (2R)-2-(4-nitrophenyl)sulfonyl-4-phenylbutanoate |
|---|---|
| PubChem CID | 91335332 |
| Molecular Formula | C18H19NO6S |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | ethyl (2R)-2-(4-nitrophenyl)sulfonyl-4-phenylbutanoate |
| SMILES | CCOC(=O)[C@@H](CCc1ccccc1)S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H19NO6S/c1-2-25-18(20)17(13-8-14-6-4-3-5-7-14)26(23,24)16-11-9-15(10-12-16)19(21)22/h3-7,9-12,17H,2,8,13H2,1H3/t17-/m1/s1 |
| InChIKey | BKMDEJQMBVZTDG-QGZVFWFLSA-N |
| XLogP | 2.93 |
| TPSA | 103.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|