C24H21F2NO6S — CID 90929181
methyl 4-[4-[difluoro-(4-nitrophenyl)methyl]phenyl]sulfonyl-4-phenylbutanoate (PubChem CID 90929181) has the molecular formula C24H21F2NO6S and a molecular weight of 489.50 g/mol. Its IUPAC name is methyl 4-[4-[difluoro-(4-nitrophenyl)methyl]phenyl]sulfonyl-4-phenylbutanoate.
| Compound Name | methyl 4-[4-[difluoro-(4-nitrophenyl)methyl]phenyl]sulfonyl-4-phenylbutanoate |
|---|---|
| PubChem CID | 90929181 |
| Molecular Formula | C24H21F2NO6S |
| Molecular Weight | 489.50 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | methyl 4-[4-[difluoro-(4-nitrophenyl)methyl]phenyl]sulfonyl-4-phenylbutanoate |
| SMILES | COC(=O)CCC(c1ccccc1)S(=O)(=O)c1ccc(C(F)(F)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C24H21F2NO6S/c1-33-23(28)16-15-22(17-5-3-2-4-6-17)34(31,32)21-13-9-19(10-14-21)24(25,26)18-7-11-20(12-8-18)27(29)30/h2-14,22H,15-16H2,1H3 |
| InChIKey | AIJOWCVPPRTPSE-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 103.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.50 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|