C13H15NO6S — CID 135058012
methyl (2S,3S)-3-(4-nitrophenyl)-1,1-dioxothiane-2-carboxylate (PubChem CID 135058012) has the molecular formula C13H15NO6S and a molecular weight of 313.33 g/mol. Its IUPAC name is methyl (2S,3S)-3-(4-nitrophenyl)-1,1-dioxothiane-2-carboxylate.
| Compound Name | methyl (2S,3S)-3-(4-nitrophenyl)-1,1-dioxothiane-2-carboxylate |
|---|---|
| PubChem CID | 135058012 |
| Molecular Formula | C13H15NO6S |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | methyl (2S,3S)-3-(4-nitrophenyl)-1,1-dioxothiane-2-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@H](c2ccc([N+](=O)[O-])cc2)CCCS1(=O)=O |
| InChI | InChI=1S/C13H15NO6S/c1-20-13(15)12-11(3-2-8-21(12,18)19)9-4-6-10(7-5-9)14(16)17/h4-7,11-12H,2-3,8H2,1H3/t11-,12-/m0/s1 |
| InChIKey | RBNATFOFDWIOKU-RYUDHWBXSA-N |
| XLogP | 1.43 |
| TPSA | 103.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|