C14H18F3NO4S — CID 149444650
tert-butyl 3-[5-amino-2-(trifluoromethylsulfonyl)phenyl]propanoate (PubChem CID 149444650) has the molecular formula C14H18F3NO4S and a molecular weight of 353.36 g/mol. Its IUPAC name is tert-butyl 3-[5-amino-2-(trifluoromethylsulfonyl)phenyl]propanoate.
| Compound Name | tert-butyl 3-[5-amino-2-(trifluoromethylsulfonyl)phenyl]propanoate |
|---|---|
| PubChem CID | 149444650 |
| Molecular Formula | C14H18F3NO4S |
| Molecular Weight | 353.36 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | tert-butyl 3-[5-amino-2-(trifluoromethylsulfonyl)phenyl]propanoate |
| SMILES | CC(C)(C)OC(=O)CCc1cc(N)ccc1S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C14H18F3NO4S/c1-13(2,3)22-12(19)7-4-9-8-10(18)5-6-11(9)23(20,21)14(15,16)17/h5-6,8H,4,7,18H2,1-3H3 |
| InChIKey | YWLCHBZRMQVDGZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|