C13H17F2NO2S — CID 116686733
tert-butyl 2-[4-amino-2-(difluoromethyl)phenyl]sulfanylacetate (PubChem CID 116686733) has the molecular formula C13H17F2NO2S and a molecular weight of 289.35 g/mol. Its IUPAC name is tert-butyl 2-[4-amino-2-(difluoromethyl)phenyl]sulfanylacetate.
| Compound Name | tert-butyl 2-[4-amino-2-(difluoromethyl)phenyl]sulfanylacetate |
|---|---|
| PubChem CID | 116686733 |
| Molecular Formula | C13H17F2NO2S |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | tert-butyl 2-[4-amino-2-(difluoromethyl)phenyl]sulfanylacetate |
| SMILES | CC(C)(C)OC(=O)CSc1ccc(N)cc1C(F)F |
| InChI | InChI=1S/C13H17F2NO2S/c1-13(2,3)18-11(17)7-19-10-5-4-8(16)6-9(10)12(14)15/h4-6,12H,7,16H2,1-3H3 |
| InChIKey | PIAQAFWBEFMKDU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|