C15H16F7NO2S — CID 145571542
Tert-butyl 2-[2-amino-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]sulfanylacetate (PubChem CID 145571542) has the molecular formula C15H16F7NO2S and a molecular weight of 407.30 g/mol. Its IUPAC name is tert-butyl 2-[2-amino-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]sulfanylacetate.
| Compound Name | Tert-butyl 2-[2-amino-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]sulfanylacetate |
|---|---|
| PubChem CID | 145571542 |
| Molecular Formula | C15H16F7NO2S |
| Molecular Weight | 407.30 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | tert-butyl 2-[2-amino-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]sulfanylacetate |
| SMILES | CC(C)(C)OC(=O)CSC1=C(C=CC(=C1)C(C(F)(F)F)(C(F)(F)F)F)N |
| InChI | InChI=1S/C15H16F7NO2S/c1-12(2,3)25-11(24)7-26-10-6-8(4-5-9(10)23)13(16,14(17,18)19)15(20,21)22/h4-6H,7,23H2,1-3H3 |
| InChIKey | IRXOPOMYPYWRGT-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 77.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | 488 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.30 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|