C17H16F3NO2S — CID 69108273
methyl 3-[2-amino-5-[4-(trifluoromethyl)phenyl]phenyl]sulfanylpropanoate (PubChem CID 69108273) has the molecular formula C17H16F3NO2S and a molecular weight of 355.38 g/mol. Its IUPAC name is methyl 3-[2-amino-5-[4-(trifluoromethyl)phenyl]phenyl]sulfanylpropanoate.
| Compound Name | methyl 3-[2-amino-5-[4-(trifluoromethyl)phenyl]phenyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 69108273 |
| Molecular Formula | C17H16F3NO2S |
| Molecular Weight | 355.38 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | methyl 3-[2-amino-5-[4-(trifluoromethyl)phenyl]phenyl]sulfanylpropanoate |
| SMILES | COC(=O)CCSc1cc(-c2ccc(C(F)(F)F)cc2)ccc1N |
| InChI | InChI=1S/C17H16F3NO2S/c1-23-16(22)8-9-24-15-10-12(4-7-14(15)21)11-2-5-13(6-3-11)17(18,19)20/h2-7,10H,8-9,21H2,1H3 |
| InChIKey | WXEMZDWBJTUUET-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.38 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|