C24H31NO6S — CID 161166177
tert-butyl (4R)-2,4-dimethyl-5-[4-[(4-nitrophenyl)sulfonylmethyl]phenyl]pentanoate (PubChem CID 161166177) has the molecular formula C24H31NO6S and a molecular weight of 461.58 g/mol. Its IUPAC name is tert-butyl (4R)-2,4-dimethyl-5-[4-[(4-nitrophenyl)sulfonylmethyl]phenyl]pentanoate.
| Compound Name | tert-butyl (4R)-2,4-dimethyl-5-[4-[(4-nitrophenyl)sulfonylmethyl]phenyl]pentanoate |
|---|---|
| PubChem CID | 161166177 |
| Molecular Formula | C24H31NO6S |
| Molecular Weight | 461.58 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | tert-butyl (4R)-2,4-dimethyl-5-[4-[(4-nitrophenyl)sulfonylmethyl]phenyl]pentanoate |
| SMILES | CC(C[C@@H](C)Cc1ccc(CS(=O)(=O)c2ccc([N+](=O)[O-])cc2)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H31NO6S/c1-17(14-18(2)23(26)31-24(3,4)5)15-19-6-8-20(9-7-19)16-32(29,30)22-12-10-21(11-13-22)25(27)28/h6-13,17-18H,14-16H2,1-5H3/t17-,18?/m1/s1 |
| InChIKey | UQOJZYKJHKDRSV-QNSVNVJESA-N |
| XLogP | 5.12 |
| TPSA | 103.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.58 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|