C18H18NO3Y- — CID 160730477
4-hydroxy-1-methyl-3-[2-(4-methylphenoxy)benzene-5-id-1-yl]pyrrolidin-2-one;yttrium (PubChem CID 160730477) has the molecular formula C18H18NO3Y- and a molecular weight of 385.25 g/mol. Its IUPAC name is 4-hydroxy-1-methyl-3-[2-(4-methylphenoxy)benzene-5-id-1-yl]pyrrolidin-2-one;yttrium.
| Compound Name | 4-hydroxy-1-methyl-3-[2-(4-methylphenoxy)benzene-5-id-1-yl]pyrrolidin-2-one;yttrium |
|---|---|
| PubChem CID | 160730477 |
| Molecular Formula | C18H18NO3Y- |
| Molecular Weight | 385.25 g/mol |
| Exact Mass | 385.04 |
| IUPAC Name | 4-hydroxy-1-methyl-3-[2-(4-methylphenoxy)benzene-5-id-1-yl]pyrrolidin-2-one;yttrium |
| SMILES | Cc1ccc(Oc2cc[c-]cc2C2C(=O)N(C)CC2O)cc1.[Y] |
| InChI | InChI=1S/C18H18NO3.Y/c1-12-7-9-13(10-8-12)22-16-6-4-3-5-14(16)17-15(20)11-19(2)18(17)21;/h4-10,15,17,20H,11H2,1-2H3;/q-1; |
| InChIKey | HICZBKZSWQLHQY-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.25 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|