C13H28N2O2 — CID 160730867
2-[acetyl(methyl)amino]-N-(4-methylpentan-2-yl)propanamide;methane (PubChem CID 160730867) has the molecular formula C13H28N2O2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 2-[acetyl(methyl)amino]-N-(4-methylpentan-2-yl)propanamide;methane.
| Compound Name | 2-[acetyl(methyl)amino]-N-(4-methylpentan-2-yl)propanamide;methane |
|---|---|
| PubChem CID | 160730867 |
| Molecular Formula | C13H28N2O2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | 2-[acetyl(methyl)amino]-N-(4-methylpentan-2-yl)propanamide;methane |
| SMILES | C.CC(=O)N(C)C(C)C(=O)NC(C)CC(C)C |
| InChI | InChI=1S/C12H24N2O2.CH4/c1-8(2)7-9(3)13-12(16)10(4)14(6)11(5)15;/h8-10H,7H2,1-6H3,(H,13,16);1H4 |
| InChIKey | RUHYCGKCPFFDKC-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |