C22H48O2 — CID 160731975
2,3,3,4,5-pentamethylhexane;3,3,4,4,5-pentamethylhexane-1,2-diol (PubChem CID 160731975) has the molecular formula C22H48O2 and a molecular weight of 344.62 g/mol. Its IUPAC name is 2,3,3,4,5-pentamethylhexane;3,3,4,4,5-pentamethylhexane-1,2-diol.
| Compound Name | 2,3,3,4,5-pentamethylhexane;3,3,4,4,5-pentamethylhexane-1,2-diol |
|---|---|
| PubChem CID | 160731975 |
| Molecular Formula | C22H48O2 |
| Molecular Weight | 344.62 g/mol |
| Exact Mass | 344.37 |
| IUPAC Name | 2,3,3,4,5-pentamethylhexane;3,3,4,4,5-pentamethylhexane-1,2-diol |
| SMILES | CC(C)C(C)(C)C(C)(C)C(O)CO.CC(C)C(C)C(C)(C)C(C)C |
| InChI | InChI=1S/C11H24O2.C11H24/c1-8(2)10(3,4)11(5,6)9(13)7-12;1-8(2)10(5)11(6,7)9(3)4/h8-9,12-13H,7H2,1-6H3;8-10H,1-7H3 |
| InChIKey | RULPAYSJFUQEOA-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.62 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |