C16H22N4O3 — CID 160734306
3-amino-3-[(2S)-2-amino-3-methylbutanoyl]-1,5-dimethyl-1,5-benzodiazepine-2,4-dione (PubChem CID 160734306) has the molecular formula C16H22N4O3 and a molecular weight of 318.38 g/mol. Its IUPAC name is 3-amino-3-[(2S)-2-amino-3-methylbutanoyl]-1,5-dimethyl-1,5-benzodiazepine-2,4-dione.
| Compound Name | 3-amino-3-[(2S)-2-amino-3-methylbutanoyl]-1,5-dimethyl-1,5-benzodiazepine-2,4-dione |
|---|---|
| PubChem CID | 160734306 |
| Molecular Formula | C16H22N4O3 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 3-amino-3-[(2S)-2-amino-3-methylbutanoyl]-1,5-dimethyl-1,5-benzodiazepine-2,4-dione |
| SMILES | CC(C)[C@H](N)C(=O)C1(N)C(=O)N(C)c2ccccc2N(C)C1=O |
| InChI | InChI=1S/C16H22N4O3/c1-9(2)12(17)13(21)16(18)14(22)19(3)10-7-5-6-8-11(10)20(4)15(16)23/h5-9,12H,17-18H2,1-4H3/t12-/m0/s1 |
| InChIKey | RUTBIVSDWACNRE-LBPRGKRZSA-N |
| XLogP | -0.12 |
| TPSA | 109.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|