C27H45NO7 — CID 160737877
[(2S,5R)-7-methyl-5-[(2R)-2-methyloxirane-2-carbonyl]-3-oxo-2-[[(2S)-4-oxo-2-propan-2-ylnonanoyl]amino]octyl] acetate (PubChem CID 160737877) has the molecular formula C27H45NO7 and a molecular weight of 495.66 g/mol. Its IUPAC name is [(2S,5R)-7-methyl-5-[(2R)-2-methyloxirane-2-carbonyl]-3-oxo-2-[[(2S)-4-oxo-2-propan-2-ylnonanoyl]amino]octyl] acetate.
| Compound Name | [(2S,5R)-7-methyl-5-[(2R)-2-methyloxirane-2-carbonyl]-3-oxo-2-[[(2S)-4-oxo-2-propan-2-ylnonanoyl]amino]octyl] acetate |
|---|---|
| PubChem CID | 160737877 |
| Molecular Formula | C27H45NO7 |
| Molecular Weight | 495.66 g/mol |
| Exact Mass | 495.32 |
| IUPAC Name | [(2S,5R)-7-methyl-5-[(2R)-2-methyloxirane-2-carbonyl]-3-oxo-2-[[(2S)-4-oxo-2-propan-2-ylnonanoyl]amino]octyl] acetate |
| SMILES | CCCCCC(=O)C[C@H](C(=O)N[C@@H](COC(C)=O)C(=O)C[C@@H](CC(C)C)C(=O)[C@@]1(C)CO1)C(C)C |
| InChI | InChI=1S/C27H45NO7/c1-8-9-10-11-21(30)14-22(18(4)5)26(33)28-23(15-34-19(6)29)24(31)13-20(12-17(2)3)25(32)27(7)16-35-27/h17-18,20,22-23H,8-16H2,1-7H3,(H,28,33)/t20-,22+,23+,27-/m1/s1 |
| InChIKey | HNJPGVVAZIVZER-RLYAYYKLSA-N |
| XLogP | 3.83 |
| TPSA | 119.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.66 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|