C26H44N4O6 — CID 123837215
N-[1-[[3-[acetyl(methyl)amino]-1-[[4-methyl-1-(2-methyloxiran-2-yl)-1-oxopentan-2-yl]amino]-1-oxopropan-2-yl]amino]-3-methyl-1-oxobut-3-en-2-yl]hexanamide (PubChem CID 123837215) has the molecular formula C26H44N4O6 and a molecular weight of 508.66 g/mol. Its IUPAC name is N-[1-[[3-[acetyl(methyl)amino]-1-[[4-methyl-1-(2-methyloxiran-2-yl)-1-oxopentan-2-yl]amino]-1-oxopropan-2-yl]amino]-3-methyl-1-oxobut-3-en-2-yl]hexanamide.
| Compound Name | N-[1-[[3-[acetyl(methyl)amino]-1-[[4-methyl-1-(2-methyloxiran-2-yl)-1-oxopentan-2-yl]amino]-1-oxopropan-2-yl]amino]-3-methyl-1-oxobut-3-en-2-yl]hexanamide |
|---|---|
| PubChem CID | 123837215 |
| Molecular Formula | C26H44N4O6 |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.33 |
| IUPAC Name | N-[1-[[3-[acetyl(methyl)amino]-1-[[4-methyl-1-(2-methyloxiran-2-yl)-1-oxopentan-2-yl]amino]-1-oxopropan-2-yl]amino]-3-methyl-1-oxobut-3-en-2-yl]hexanamide |
| SMILES | C=C(C)C(NC(=O)CCCCC)C(=O)NC(CN(C)C(C)=O)C(=O)NC(CC(C)C)C(=O)C1(C)CO1 |
| InChI | InChI=1S/C26H44N4O6/c1-9-10-11-12-21(32)29-22(17(4)5)25(35)28-20(14-30(8)18(6)31)24(34)27-19(13-16(2)3)23(33)26(7)15-36-26/h16,19-20,22H,4,9-15H2,1-3,5-8H3,(H,27,34)(H,28,35)(H,29,32) |
| InChIKey | NYBGKUXMJFCUJJ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 137.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|