C16H34NdO4P-2 — CID 160737931
3-methanidylheptane;neodymium(3+);octane;phosphate (PubChem CID 160737931) has the molecular formula C16H34NdO4P-2 and a molecular weight of 465.66 g/mol. Its IUPAC name is 3-methanidylheptane;neodymium(3+);octane;phosphate.
| Compound Name | 3-methanidylheptane;neodymium(3+);octane;phosphate |
|---|---|
| PubChem CID | 160737931 |
| Molecular Formula | C16H34NdO4P-2 |
| Molecular Weight | 465.66 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | 3-methanidylheptane;neodymium(3+);octane;phosphate |
| SMILES | C[CH-]CCCCCC.O=P([O-])([O-])[O-].[CH2-]C(CC)CCCC.[Nd+3] |
| InChI | InChI=1S/2C8H17.Nd.H3O4P/c1-4-6-7-8(3)5-2;1-3-5-7-8-6-4-2;;1-5(2,3)4/h8H,3-7H2,1-2H3;3H,4-8H2,1-2H3;;(H3,1,2,3,4)/q2*-1;+3;/p-3 |
| InChIKey | JNNWXDNJIFBBES-UHFFFAOYSA-K |
| XLogP | 3.39 |
| TPSA | 86.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.66 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|