C24H18Cl2N2O6 — CID 160738142
4-(5-chloro-1H-indol-3-yl)-4-hydroxybut-3-en-2-one;4-(5-chloro-1H-indol-3-yl)-4-hydroxy-2-oxobut-3-enoic acid (PubChem CID 160738142) has the molecular formula C24H18Cl2N2O6 and a molecular weight of 501.32 g/mol. Its IUPAC name is 4-(5-chloro-1H-indol-3-yl)-4-hydroxybut-3-en-2-one;4-(5-chloro-1H-indol-3-yl)-4-hydroxy-2-oxobut-3-enoic acid.
| Compound Name | 4-(5-chloro-1H-indol-3-yl)-4-hydroxybut-3-en-2-one;4-(5-chloro-1H-indol-3-yl)-4-hydroxy-2-oxobut-3-enoic acid |
|---|---|
| PubChem CID | 160738142 |
| Molecular Formula | C24H18Cl2N2O6 |
| Molecular Weight | 501.32 g/mol |
| Exact Mass | 500.05 |
| IUPAC Name | 4-(5-chloro-1H-indol-3-yl)-4-hydroxybut-3-en-2-one;4-(5-chloro-1H-indol-3-yl)-4-hydroxy-2-oxobut-3-enoic acid |
| SMILES | CC(=O)C=C(O)c1c[nH]c2ccc(Cl)cc12.O=C(O)C(=O)C=C(O)c1c[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C12H8ClNO4.C12H10ClNO2/c13-6-1-2-9-7(3-6)8(5-14-9)10(15)4-11(16)12(17)18;1-7(15)4-12(16)10-6-14-11-3-2-8(13)5-9(10)11/h1-5,14-15H,(H,17,18);2-6,14,16H,1H3 |
| InChIKey | BDAUKBQZWUJHBP-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 143.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.32 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|