C34H49N9O5Zn+2 — CID 160740836
zinc (2S,3S,4R,5R)-5-[6-[[(1R)-2,3-dihydro-1H-inden-1-yl]methyl]purin-9-yl]-3,4-dihydroxy-N-[6-oxo-6-(1,4,7,10-tetrazacyclododec-1-yl)hexyl]oxolane-2-carboxamide (PubChem CID 160740836) has the molecular formula C34H49N9O5Zn+2 and a molecular weight of 729.21 g/mol. Its IUPAC name is zinc (2S,3S,4R,5R)-5-[6-[[(1R)-2,3-dihydro-1H-inden-1-yl]methyl]purin-9-yl]-3,4-dihydroxy-N-[6-oxo-6-(1,4,7,10-tetrazacyclododec-1-yl)hexyl]oxolane-2-carboxamide.
| Compound Name | zinc (2S,3S,4R,5R)-5-[6-[[(1R)-2,3-dihydro-1H-inden-1-yl]methyl]purin-9-yl]-3,4-dihydroxy-N-[6-oxo-6-(1,4,7,10-tetrazacyclododec-1-yl)hexyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 160740836 |
| Molecular Formula | C34H49N9O5Zn+2 |
| Molecular Weight | 729.21 g/mol |
| Exact Mass | 727.31 |
| IUPAC Name | zinc (2S,3S,4R,5R)-5-[6-[[(1R)-2,3-dihydro-1H-inden-1-yl]methyl]purin-9-yl]-3,4-dihydroxy-N-[6-oxo-6-(1,4,7,10-tetrazacyclododec-1-yl)hexyl]oxolane-2-carboxamide |
| SMILES | O=C(NCCCCCC(=O)N1CCNCCNCCNCC1)[C@H]1O[C@@H](n2cnc3c(C[C@H]4CCc5ccccc54)ncnc32)[C@H](O)[C@@H]1O.[Zn+2] |
| InChI | InChI=1S/C34H49N9O5.Zn/c44-27(42-18-16-36-14-12-35-13-15-37-17-19-42)8-2-1-5-11-38-33(47)31-29(45)30(46)34(48-31)43-22-41-28-26(39-21-40-32(28)43)20-24-10-9-23-6-3-4-7-25(23)24;/h3-4,6-7,21-22,24,29-31,34-37,45-46H,1-2,5,8-20H2,(H,38,47);/q;+2/t24-,29+,30-,31+,34-;/m1./s1 |
| InChIKey | RVOCQSHIGIOPBP-YBZTYAQASA-N |
| XLogP | 0.00 |
| TPSA | 178.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.21 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|