C19H20N6O5 — CID 51360247
(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]oxolane-2-carboxamide (PubChem CID 51360247) has the molecular formula C19H20N6O5 and a molecular weight of 412.41 g/mol. Its IUPAC name is (2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]oxolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 51360247 |
| Molecular Formula | C19H20N6O5 |
| Molecular Weight | 412.41 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | (2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]oxolane-2-carboxamide |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](C(=O)N[C@H]2c3ccccc3C[C@H]2O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C19H20N6O5/c20-16-12-17(22-6-21-16)25(7-23-12)19-14(28)13(27)15(30-19)18(29)24-11-9-4-2-1-3-8(9)5-10(11)26/h1-4,6-7,10-11,13-15,19,26-28H,5H2,(H,24,29)(H2,20,21,22)/t10-,11+,13+,14-,15+,19-/m1/s1 |
| InChIKey | ZOGMAXMIGBTMQR-KKHNSLHASA-N |
| XLogP | -1.20 |
| TPSA | 168.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.41 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |