C48H64BBrN4O2 — CID 160745451
2,3-bis(2-methylpropyl)phenanthridin-6-amine;2-bromo-4,5-bis(2-methylpropyl)aniline;2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (PubChem CID 160745451) has the molecular formula C48H64BBrN4O2 and a molecular weight of 819.78 g/mol. Its IUPAC name is 2,3-bis(2-methylpropyl)phenanthridin-6-amine;2-bromo-4,5-bis(2-methylpropyl)aniline;2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile.
| Compound Name | 2,3-bis(2-methylpropyl)phenanthridin-6-amine;2-bromo-4,5-bis(2-methylpropyl)aniline;2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
|---|---|
| PubChem CID | 160745451 |
| Molecular Formula | C48H64BBrN4O2 |
| Molecular Weight | 819.78 g/mol |
| Exact Mass | 818.43 |
| IUPAC Name | 2,3-bis(2-methylpropyl)phenanthridin-6-amine;2-bromo-4,5-bis(2-methylpropyl)aniline;2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
| SMILES | CC(C)Cc1cc(N)c(Br)cc1CC(C)C.CC(C)Cc1cc2nc(N)c3ccccc3c2cc1CC(C)C.CC1(C)OB(c2ccccc2C#N)OC1(C)C |
| InChI | InChI=1S/C21H26N2.C14H22BrN.C13H16BNO2/c1-13(2)9-15-11-19-17-7-5-6-8-18(17)21(22)23-20(19)12-16(15)10-14(3)4;1-9(2)5-11-7-13(15)14(16)8-12(11)6-10(3)4;1-12(2)13(3,4)17-14(16-12)11-8-6-5-7-10(11)9-15/h5-8,11-14H,9-10H2,1-4H3,(H2,22,23);7-10H,5-6,16H2,1-4H3;5-8H,1-4H3 |
| InChIKey | RWDFVHCFCHTXID-UHFFFAOYSA-N |
| XLogP | 11.65 |
| TPSA | 107.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.78 |
| LogP ≤ 5 | 11.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|