C32H32BIN4O2 — CID 160899395
2-iodoaniline;phenanthridin-6-amine;2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (PubChem CID 160899395) has the molecular formula C32H32BIN4O2 and a molecular weight of 642.35 g/mol. Its IUPAC name is 2-iodoaniline;phenanthridin-6-amine;2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile.
| Compound Name | 2-iodoaniline;phenanthridin-6-amine;2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
|---|---|
| PubChem CID | 160899395 |
| Molecular Formula | C32H32BIN4O2 |
| Molecular Weight | 642.35 g/mol |
| Exact Mass | 642.17 |
| IUPAC Name | 2-iodoaniline;phenanthridin-6-amine;2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
| SMILES | CC1(C)OB(c2ccccc2C#N)OC1(C)C.Nc1ccccc1I.Nc1nc2ccccc2c2ccccc12 |
| InChI | InChI=1S/C13H16BNO2.C13H10N2.C6H6IN/c1-12(2)13(3,4)17-14(16-12)11-8-6-5-7-10(11)9-15;14-13-11-7-2-1-5-9(11)10-6-3-4-8-12(10)15-13;7-5-3-1-2-4-6(5)8/h5-8H,1-4H3;1-8H,(H2,14,15);1-4H,8H2 |
| InChIKey | SPHJUKMHIKULAI-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 107.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.35 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|