C32H34BClN6O2 — CID 157137034
2-chloro-6-methylpyridine-3-carbonitrile;2-methylbenzo[h][1,6]naphthyridin-5-amine;2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (PubChem CID 157137034) has the molecular formula C32H34BClN6O2 and a molecular weight of 580.93 g/mol. Its IUPAC name is 2-chloro-6-methylpyridine-3-carbonitrile;2-methylbenzo[h][1,6]naphthyridin-5-amine;2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline.
| Compound Name | 2-chloro-6-methylpyridine-3-carbonitrile;2-methylbenzo[h][1,6]naphthyridin-5-amine;2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
|---|---|
| PubChem CID | 157137034 |
| Molecular Formula | C32H34BClN6O2 |
| Molecular Weight | 580.93 g/mol |
| Exact Mass | 580.25 |
| IUPAC Name | 2-chloro-6-methylpyridine-3-carbonitrile;2-methylbenzo[h][1,6]naphthyridin-5-amine;2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| SMILES | CC1(C)OB(c2ccccc2N)OC1(C)C.Cc1ccc(C#N)c(Cl)n1.Cc1ccc2c(N)nc3ccccc3c2n1 |
| InChI | InChI=1S/C13H11N3.C12H18BNO2.C7H5ClN2/c1-8-6-7-10-12(15-8)9-4-2-3-5-11(9)16-13(10)14;1-11(2)12(3,4)16-13(15-11)9-7-5-6-8-10(9)14;1-5-2-3-6(4-9)7(8)10-5/h2-7H,1H3,(H2,14,16);5-8H,14H2,1-4H3;2-3H,1H3 |
| InChIKey | AJSXKPMBRBSHCT-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.93 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|