C34H30BCl3N4O2 — CID 159930416
2-chloro-4-phenylquinazoline;2,4-dichloroquinazoline;4,4,5,5-tetramethyl-2-phenyl-1,3,2-dioxaborolane (PubChem CID 159930416) has the molecular formula C34H30BCl3N4O2 and a molecular weight of 643.81 g/mol. Its IUPAC name is 2-chloro-4-phenylquinazoline;2,4-dichloroquinazoline;4,4,5,5-tetramethyl-2-phenyl-1,3,2-dioxaborolane.
| Compound Name | 2-chloro-4-phenylquinazoline;2,4-dichloroquinazoline;4,4,5,5-tetramethyl-2-phenyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 159930416 |
| Molecular Formula | C34H30BCl3N4O2 |
| Molecular Weight | 643.81 g/mol |
| Exact Mass | 642.15 |
| IUPAC Name | 2-chloro-4-phenylquinazoline;2,4-dichloroquinazoline;4,4,5,5-tetramethyl-2-phenyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2ccccc2)OC1(C)C.Clc1nc(-c2ccccc2)c2ccccc2n1.Clc1nc(Cl)c2ccccc2n1 |
| InChI | InChI=1S/C14H9ClN2.C12H17BO2.C8H4Cl2N2/c15-14-16-12-9-5-4-8-11(12)13(17-14)10-6-2-1-3-7-10;1-11(2)12(3,4)15-13(14-11)10-8-6-5-7-9-10;9-7-5-3-1-2-4-6(5)11-8(10)12-7/h1-9H;5-9H,1-4H3;1-4H |
| InChIKey | NZOIOPPXBIMOPG-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 70.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.81 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|