C56H45BN4O2 — CID 123552382
2-[3-[3-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]-4,6-diphenylpyrimidine (PubChem CID 123552382) has the molecular formula C56H45BN4O2 and a molecular weight of 816.81 g/mol. Its IUPAC name is 2-[3-[3-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]-4,6-diphenylpyrimidine.
| Compound Name | 2-[3-[3-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]-4,6-diphenylpyrimidine |
|---|---|
| PubChem CID | 123552382 |
| Molecular Formula | C56H45BN4O2 |
| Molecular Weight | 816.81 g/mol |
| Exact Mass | 816.36 |
| IUPAC Name | 2-[3-[3-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]-4,6-diphenylpyrimidine |
| SMILES | CC1(C)OB(c2cc(-c3cccc(-c4nc(-c5ccccc5)cc(-c5ccccc5)n4)c3)cc(-c3cccc(-c4nc(-c5ccccc5)cc(-c5ccccc5)n4)c3)c2)OC1(C)C |
| InChI | InChI=1S/C56H45BN4O2/c1-55(2)56(3,4)63-57(62-55)48-34-46(42-27-17-29-44(31-42)53-58-49(38-19-9-5-10-20-38)36-50(59-53)39-21-11-6-12-22-39)33-47(35-48)43-28-18-30-45(32-43)54-60-51(40-23-13-7-14-24-40)37-52(61-54)41-25-15-8-16-26-41/h5-37H,1-4H3 |
| InChIKey | AMQPXJJJCMQWAI-UHFFFAOYSA-N |
| XLogP | 12.90 |
| TPSA | 70.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.81 |
| LogP ≤ 5 | 12.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|