C35H41N3O5 — CID 160750321
tert-butyl N-methyl-N-[(2S)-1-oxo-1-(3-phenylmethoxyanilino)propan-2-yl]carbamate;3-phenylmethoxyaniline (PubChem CID 160750321) has the molecular formula C35H41N3O5 and a molecular weight of 583.73 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[(2S)-1-oxo-1-(3-phenylmethoxyanilino)propan-2-yl]carbamate;3-phenylmethoxyaniline.
| Compound Name | tert-butyl N-methyl-N-[(2S)-1-oxo-1-(3-phenylmethoxyanilino)propan-2-yl]carbamate;3-phenylmethoxyaniline |
|---|---|
| PubChem CID | 160750321 |
| Molecular Formula | C35H41N3O5 |
| Molecular Weight | 583.73 g/mol |
| Exact Mass | 583.30 |
| IUPAC Name | tert-butyl N-methyl-N-[(2S)-1-oxo-1-(3-phenylmethoxyanilino)propan-2-yl]carbamate;3-phenylmethoxyaniline |
| SMILES | C[C@@H](C(=O)Nc1cccc(OCc2ccccc2)c1)N(C)C(=O)OC(C)(C)C.Nc1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C22H28N2O4.C13H13NO/c1-16(24(5)21(26)28-22(2,3)4)20(25)23-18-12-9-13-19(14-18)27-15-17-10-7-6-8-11-17;14-12-7-4-8-13(9-12)15-10-11-5-2-1-3-6-11/h6-14,16H,15H2,1-5H3,(H,23,25);1-9H,10,14H2/t16-;/m0./s1 |
| InChIKey | RWSPGMNQOQBZAE-NTISSMGPSA-N |
| XLogP | 7.31 |
| TPSA | 103.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.73 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|