C20H39NO7 — CID 160752689
tert-butyl 2-(2-methylpropyl)-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]hexanoate (PubChem CID 160752689) has the molecular formula C20H39NO7 and a molecular weight of 405.53 g/mol. Its IUPAC name is tert-butyl 2-(2-methylpropyl)-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]hexanoate.
| Compound Name | tert-butyl 2-(2-methylpropyl)-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]hexanoate |
|---|---|
| PubChem CID | 160752689 |
| Molecular Formula | C20H39NO7 |
| Molecular Weight | 405.53 g/mol |
| Exact Mass | 405.27 |
| IUPAC Name | tert-butyl 2-(2-methylpropyl)-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]hexanoate |
| SMILES | CC(C)CC(CCCCNC1OC(CO)C(O)C(O)C1O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H39NO7/c1-12(2)10-13(19(26)28-20(3,4)5)8-6-7-9-21-18-17(25)16(24)15(23)14(11-22)27-18/h12-18,21-25H,6-11H2,1-5H3 |
| InChIKey | YHARILDJDYFHMK-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 128.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.53 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|