C30H23ClN2O3 — CID 160755876
2-[2-(1H-benzimidazol-2-yl)-5-chlorophenyl]-5-[(3S)-3-phenylbutanoyl]benzoic acid (PubChem CID 160755876) has the molecular formula C30H23ClN2O3 and a molecular weight of 494.98 g/mol. Its IUPAC name is 2-[2-(1H-benzimidazol-2-yl)-5-chlorophenyl]-5-[(3S)-3-phenylbutanoyl]benzoic acid.
| Compound Name | 2-[2-(1H-benzimidazol-2-yl)-5-chlorophenyl]-5-[(3S)-3-phenylbutanoyl]benzoic acid |
|---|---|
| PubChem CID | 160755876 |
| Molecular Formula | C30H23ClN2O3 |
| Molecular Weight | 494.98 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | 2-[2-(1H-benzimidazol-2-yl)-5-chlorophenyl]-5-[(3S)-3-phenylbutanoyl]benzoic acid |
| SMILES | C[C@@H](CC(=O)c1ccc(-c2cc(Cl)ccc2-c2nc3ccccc3[nH]2)c(C(=O)O)c1)c1ccccc1 |
| InChI | InChI=1S/C30H23ClN2O3/c1-18(19-7-3-2-4-8-19)15-28(34)20-11-13-22(25(16-20)30(35)36)24-17-21(31)12-14-23(24)29-32-26-9-5-6-10-27(26)33-29/h2-14,16-18H,15H2,1H3,(H,32,33)(H,35,36)/t18-/m0/s1 |
| InChIKey | RXKQJPDQBPYETB-SFHVURJKSA-N |
| XLogP | 7.62 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.98 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |