C33H30N2O4 — CID 158678688
2-[2-(1H-benzimidazol-2-yl)-5-methoxyphenyl]-5-[(3S)-3-phenylhexanoyl]benzoic acid (PubChem CID 158678688) has the molecular formula C33H30N2O4 and a molecular weight of 518.61 g/mol. Its IUPAC name is 2-[2-(1H-benzimidazol-2-yl)-5-methoxyphenyl]-5-[(3S)-3-phenylhexanoyl]benzoic acid.
| Compound Name | 2-[2-(1H-benzimidazol-2-yl)-5-methoxyphenyl]-5-[(3S)-3-phenylhexanoyl]benzoic acid |
|---|---|
| PubChem CID | 158678688 |
| Molecular Formula | C33H30N2O4 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | 2-[2-(1H-benzimidazol-2-yl)-5-methoxyphenyl]-5-[(3S)-3-phenylhexanoyl]benzoic acid |
| SMILES | CCC[C@@H](CC(=O)c1ccc(-c2cc(OC)ccc2-c2nc3ccccc3[nH]2)c(C(=O)O)c1)c1ccccc1 |
| InChI | InChI=1S/C33H30N2O4/c1-3-9-22(21-10-5-4-6-11-21)19-31(36)23-14-16-25(28(18-23)33(37)38)27-20-24(39-2)15-17-26(27)32-34-29-12-7-8-13-30(29)35-32/h4-8,10-18,20,22H,3,9,19H2,1-2H3,(H,34,35)(H,37,38)/t22-/m0/s1 |
| InChIKey | IEVNZBYXNNNMPB-QFIPXVFZSA-N |
| XLogP | 7.76 |
| TPSA | 92.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |